C14H22BrNO3 — CID 103181139
[3-bromo-4-[2-(3-methoxypropoxy)ethoxymethyl]phenyl]methanamine (PubChem CID 103181139) has the molecular formula C14H22BrNO3 and a molecular weight of 332.24 g/mol. Its IUPAC name is [3-bromo-4-[2-(3-methoxypropoxy)ethoxymethyl]phenyl]methanamine.
| Compound Name | [3-bromo-4-[2-(3-methoxypropoxy)ethoxymethyl]phenyl]methanamine |
|---|---|
| PubChem CID | 103181139 |
| Molecular Formula | C14H22BrNO3 |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | [3-bromo-4-[2-(3-methoxypropoxy)ethoxymethyl]phenyl]methanamine |
| SMILES | COCCCOCCOCc1ccc(CN)cc1Br |
| InChI | InChI=1S/C14H22BrNO3/c1-17-5-2-6-18-7-8-19-11-13-4-3-12(10-16)9-14(13)15/h3-4,9H,2,5-8,10-11,16H2,1H3 |
| InChIKey | GQBQRTBQLWVCBI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|