C13H19Br2NO3 — CID 107741510
[3,5-dibromo-4-[2-(3-methoxypropoxy)ethoxy]phenyl]methanamine (PubChem CID 107741510) has the molecular formula C13H19Br2NO3 and a molecular weight of 397.11 g/mol. Its IUPAC name is [3,5-dibromo-4-[2-(3-methoxypropoxy)ethoxy]phenyl]methanamine.
| Compound Name | [3,5-dibromo-4-[2-(3-methoxypropoxy)ethoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 107741510 |
| Molecular Formula | C13H19Br2NO3 |
| Molecular Weight | 397.11 g/mol |
| Exact Mass | 394.97 |
| IUPAC Name | [3,5-dibromo-4-[2-(3-methoxypropoxy)ethoxy]phenyl]methanamine |
| SMILES | COCCCOCCOc1c(Br)cc(CN)cc1Br |
| InChI | InChI=1S/C13H19Br2NO3/c1-17-3-2-4-18-5-6-19-13-11(14)7-10(9-16)8-12(13)15/h7-8H,2-6,9,16H2,1H3 |
| InChIKey | LNTFFHWIYAUAEV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.11 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|