C10H13Br2NO — CID 107741477
(3,5-dibromo-4-propoxyphenyl)methanamine (PubChem CID 107741477) has the molecular formula C10H13Br2NO and a molecular weight of 323.03 g/mol. Its IUPAC name is (3,5-dibromo-4-propoxyphenyl)methanamine.
| Compound Name | (3,5-dibromo-4-propoxyphenyl)methanamine |
|---|---|
| PubChem CID | 107741477 |
| Molecular Formula | C10H13Br2NO |
| Molecular Weight | 323.03 g/mol |
| Exact Mass | 320.94 |
| IUPAC Name | (3,5-dibromo-4-propoxyphenyl)methanamine |
| SMILES | CCCOc1c(Br)cc(CN)cc1Br |
| InChI | InChI=1S/C10H13Br2NO/c1-2-3-14-10-8(11)4-7(6-13)5-9(10)12/h4-5H,2-3,6,13H2,1H3 |
| InChIKey | PLAVSKYNVRPONV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.03 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |