C15H14Br3NO2 — CID 107741280
[3,5-dibromo-4-[2-(4-bromophenoxy)ethoxy]phenyl]methanamine (PubChem CID 107741280) has the molecular formula C15H14Br3NO2 and a molecular weight of 479.99 g/mol. Its IUPAC name is [3,5-dibromo-4-[2-(4-bromophenoxy)ethoxy]phenyl]methanamine.
| Compound Name | [3,5-dibromo-4-[2-(4-bromophenoxy)ethoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 107741280 |
| Molecular Formula | C15H14Br3NO2 |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 476.86 |
| IUPAC Name | [3,5-dibromo-4-[2-(4-bromophenoxy)ethoxy]phenyl]methanamine |
| SMILES | NCc1cc(Br)c(OCCOc2ccc(Br)cc2)c(Br)c1 |
| InChI | InChI=1S/C15H14Br3NO2/c16-11-1-3-12(4-2-11)20-5-6-21-15-13(17)7-10(9-19)8-14(15)18/h1-4,7-8H,5-6,9,19H2 |
| InChIKey | CWQZXEAEVRDRMN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|