C16H17Br2NO — CID 107741554
[3,5-dibromo-4-[(4-ethylphenyl)methoxy]phenyl]methanamine (PubChem CID 107741554) has the molecular formula C16H17Br2NO and a molecular weight of 399.13 g/mol. Its IUPAC name is [3,5-dibromo-4-[(4-ethylphenyl)methoxy]phenyl]methanamine.
| Compound Name | [3,5-dibromo-4-[(4-ethylphenyl)methoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 107741554 |
| Molecular Formula | C16H17Br2NO |
| Molecular Weight | 399.13 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | [3,5-dibromo-4-[(4-ethylphenyl)methoxy]phenyl]methanamine |
| SMILES | CCc1ccc(COc2c(Br)cc(CN)cc2Br)cc1 |
| InChI | InChI=1S/C16H17Br2NO/c1-2-11-3-5-12(6-4-11)10-20-16-14(17)7-13(9-19)8-15(16)18/h3-8H,2,9-10,19H2,1H3 |
| InChIKey | LGMKKEVUYANDRH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.13 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |