C11H14Br2O2 — CID 107738793
(3,5-dibromo-4-butoxyphenyl)methanol (PubChem CID 107738793) has the molecular formula C11H14Br2O2 and a molecular weight of 338.04 g/mol. Its IUPAC name is (3,5-dibromo-4-butoxyphenyl)methanol.
| Compound Name | (3,5-dibromo-4-butoxyphenyl)methanol |
|---|---|
| PubChem CID | 107738793 |
| Molecular Formula | C11H14Br2O2 |
| Molecular Weight | 338.04 g/mol |
| Exact Mass | 335.94 |
| IUPAC Name | (3,5-dibromo-4-butoxyphenyl)methanol |
| SMILES | CCCCOc1c(Br)cc(CO)cc1Br |
| InChI | InChI=1S/C11H14Br2O2/c1-2-3-4-15-11-9(12)5-8(7-14)6-10(11)13/h5-6,14H,2-4,7H2,1H3 |
| InChIKey | GXTKXXOZWSVHOP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.04 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|