C15H14Br2O2 — CID 107739120
[3,5-dibromo-4-(2-phenylethoxy)phenyl]methanol (PubChem CID 107739120) has the molecular formula C15H14Br2O2 and a molecular weight of 386.08 g/mol. Its IUPAC name is [3,5-dibromo-4-(2-phenylethoxy)phenyl]methanol.
| Compound Name | [3,5-dibromo-4-(2-phenylethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 107739120 |
| Molecular Formula | C15H14Br2O2 |
| Molecular Weight | 386.08 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | [3,5-dibromo-4-(2-phenylethoxy)phenyl]methanol |
| SMILES | OCc1cc(Br)c(OCCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C15H14Br2O2/c16-13-8-12(10-18)9-14(17)15(13)19-7-6-11-4-2-1-3-5-11/h1-5,8-9,18H,6-7,10H2 |
| InChIKey | QHNCHVSBYYNLAC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.08 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |