C21H19BrO3 — CID 10431016
[3-bromo-4,5-bis(phenylmethoxy)phenyl]methanol (PubChem CID 10431016) has the molecular formula C21H19BrO3 and a molecular weight of 399.28 g/mol. Its IUPAC name is [3-bromo-4,5-bis(phenylmethoxy)phenyl]methanol.
| Compound Name | [3-bromo-4,5-bis(phenylmethoxy)phenyl]methanol |
|---|---|
| PubChem CID | 10431016 |
| Molecular Formula | C21H19BrO3 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | [3-bromo-4,5-bis(phenylmethoxy)phenyl]methanol |
| SMILES | OCc1cc(Br)c(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H19BrO3/c22-19-11-18(13-23)12-20(24-14-16-7-3-1-4-8-16)21(19)25-15-17-9-5-2-6-10-17/h1-12,23H,13-15H2 |
| InChIKey | JENDTMZXZAVBHX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |