C17H16BrO5- — CID 3252581
4-[[2-bromo-6-ethoxy-4-(hydroxymethyl)phenoxy]methyl]benzoate (PubChem CID 3252581) has the molecular formula C17H16BrO5- and a molecular weight of 380.21 g/mol. Its IUPAC name is 4-[[2-bromo-6-ethoxy-4-(hydroxymethyl)phenoxy]methyl]benzoate.
| Compound Name | 4-[[2-bromo-6-ethoxy-4-(hydroxymethyl)phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 3252581 |
| Molecular Formula | C17H16BrO5- |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | 4-[[2-bromo-6-ethoxy-4-(hydroxymethyl)phenoxy]methyl]benzoate |
| SMILES | CCOc1cc(CO)cc(Br)c1OCc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C17H17BrO5/c1-2-22-15-8-12(9-19)7-14(18)16(15)23-10-11-3-5-13(6-4-11)17(20)21/h3-8,19H,2,9-10H2,1H3,(H,20,21)/p-1 |
| InChIKey | IVQNZRSYVDQQKS-UHFFFAOYSA-M |
| XLogP | 2.28 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |