C14H19BrO3 — CID 65459217
[3-bromo-4-(cyclobutylmethoxy)-5-ethoxyphenyl]methanol (PubChem CID 65459217) has the molecular formula C14H19BrO3 and a molecular weight of 315.21 g/mol. Its IUPAC name is [3-bromo-4-(cyclobutylmethoxy)-5-ethoxyphenyl]methanol.
| Compound Name | [3-bromo-4-(cyclobutylmethoxy)-5-ethoxyphenyl]methanol |
|---|---|
| PubChem CID | 65459217 |
| Molecular Formula | C14H19BrO3 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | [3-bromo-4-(cyclobutylmethoxy)-5-ethoxyphenyl]methanol |
| SMILES | CCOc1cc(CO)cc(Br)c1OCC1CCC1 |
| InChI | InChI=1S/C14H19BrO3/c1-2-17-13-7-11(8-16)6-12(15)14(13)18-9-10-4-3-5-10/h6-7,10,16H,2-5,8-9H2,1H3 |
| InChIKey | JOJVSRVLJJSIPR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |