C16H24O4 — CID 15752535
[4-(cyclohexylmethoxy)-3,5-dimethoxyphenyl]methanol (PubChem CID 15752535) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is [4-(cyclohexylmethoxy)-3,5-dimethoxyphenyl]methanol.
| Compound Name | [4-(cyclohexylmethoxy)-3,5-dimethoxyphenyl]methanol |
|---|---|
| PubChem CID | 15752535 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | [4-(cyclohexylmethoxy)-3,5-dimethoxyphenyl]methanol |
| SMILES | COc1cc(CO)cc(OC)c1OCC1CCCCC1 |
| InChI | InChI=1S/C16H24O4/c1-18-14-8-13(10-17)9-15(19-2)16(14)20-11-12-6-4-3-5-7-12/h8-9,12,17H,3-7,10-11H2,1-2H3 |
| InChIKey | CMWWGMYUWKSGQZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |