C17H15O5- — CID 4745695
4-[(2-ethoxy-4-formylphenoxy)methyl]benzoate (PubChem CID 4745695) has the molecular formula C17H15O5- and a molecular weight of 299.30 g/mol. Its IUPAC name is 4-[(2-ethoxy-4-formylphenoxy)methyl]benzoate.
| Compound Name | 4-[(2-ethoxy-4-formylphenoxy)methyl]benzoate |
|---|---|
| PubChem CID | 4745695 |
| Molecular Formula | C17H15O5- |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 4-[(2-ethoxy-4-formylphenoxy)methyl]benzoate |
| SMILES | CCOc1cc(C=O)ccc1OCc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C17H16O5/c1-2-21-16-9-13(10-18)5-8-15(16)22-11-12-3-6-14(7-4-12)17(19)20/h3-10H,2,11H2,1H3,(H,19,20)/p-1 |
| InChIKey | ZGARMGZKPDRTSV-UHFFFAOYSA-M |
| XLogP | 1.84 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|