C20H17N2O6- — CID 7371539
4-[[4-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-2-ethoxyphenoxy]methyl]benzoate (PubChem CID 7371539) has the molecular formula C20H17N2O6- and a molecular weight of 381.36 g/mol. Its IUPAC name is 4-[[4-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-2-ethoxyphenoxy]methyl]benzoate.
| Compound Name | 4-[[4-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-2-ethoxyphenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 7371539 |
| Molecular Formula | C20H17N2O6- |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 4-[[4-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]-2-ethoxyphenoxy]methyl]benzoate |
| SMILES | CCOc1cc(/C=C2/NC(=O)NC2=O)ccc1OCc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C20H18N2O6/c1-2-27-17-10-13(9-15-18(23)22-20(26)21-15)5-8-16(17)28-11-12-3-6-14(7-4-12)19(24)25/h3-10H,2,11H2,1H3,(H,24,25)(H2,21,22,23,26)/p-1/b15-9+ |
| InChIKey | MZVADKMZIYEOBN-OQLLNIDSSA-M |
| XLogP | 1.21 |
| TPSA | 116.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|