C17H12BrIN2O3 — CID 5099925
5-[[4-[(4-bromophenyl)methoxy]-3-iodophenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 5099925) has the molecular formula C17H12BrIN2O3 and a molecular weight of 499.10 g/mol. Its IUPAC name is 5-[[4-[(4-bromophenyl)methoxy]-3-iodophenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | 5-[[4-[(4-bromophenyl)methoxy]-3-iodophenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 5099925 |
| Molecular Formula | C17H12BrIN2O3 |
| Molecular Weight | 499.10 g/mol |
| Exact Mass | 497.91 |
| IUPAC Name | 5-[[4-[(4-bromophenyl)methoxy]-3-iodophenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccc(OCc3ccc(Br)cc3)c(I)c2)N1 |
| InChI | InChI=1S/C17H12BrIN2O3/c18-12-4-1-10(2-5-12)9-24-15-6-3-11(7-13(15)19)8-14-16(22)21-17(23)20-14/h1-8H,9H2,(H2,20,21,22,23) |
| InChIKey | CMKRHMLCJIRIBL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.10 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|