C25H16BrIN2O6 — CID 124601147
(5E)-1-(1,3-benzodioxol-5-yl)-5-[[4-[(4-bromophenyl)methoxy]-3-iodophenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 124601147) has the molecular formula C25H16BrIN2O6 and a molecular weight of 647.22 g/mol. Its IUPAC name is (5E)-1-(1,3-benzodioxol-5-yl)-5-[[4-[(4-bromophenyl)methoxy]-3-iodophenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(1,3-benzodioxol-5-yl)-5-[[4-[(4-bromophenyl)methoxy]-3-iodophenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 124601147 |
| Molecular Formula | C25H16BrIN2O6 |
| Molecular Weight | 647.22 g/mol |
| Exact Mass | 645.92 |
| IUPAC Name | (5E)-1-(1,3-benzodioxol-5-yl)-5-[[4-[(4-bromophenyl)methoxy]-3-iodophenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccc3c(c2)OCO3)C(=O)/C1=C/c1ccc(OCc2ccc(Br)cc2)c(I)c1 |
| InChI | InChI=1S/C25H16BrIN2O6/c26-16-4-1-14(2-5-16)12-33-20-7-3-15(10-19(20)27)9-18-23(30)28-25(32)29(24(18)31)17-6-8-21-22(11-17)35-13-34-21/h1-11H,12-13H2,(H,28,30,32)/b18-9+ |
| InChIKey | UFECURBDTCTVMR-GIJQJNRQSA-N |
| XLogP | 5.03 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.22 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|