C28H20BrFN2O6 — CID 124532065
(5E)-1-(1,3-benzodioxol-5-yl)-5-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 124532065) has the molecular formula C28H20BrFN2O6 and a molecular weight of 579.38 g/mol. Its IUPAC name is (5E)-1-(1,3-benzodioxol-5-yl)-5-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(1,3-benzodioxol-5-yl)-5-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 124532065 |
| Molecular Formula | C28H20BrFN2O6 |
| Molecular Weight | 579.38 g/mol |
| Exact Mass | 578.05 |
| IUPAC Name | (5E)-1-(1,3-benzodioxol-5-yl)-5-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCc1cc(/C=C2\C(=O)NC(=O)N(c3ccc4c(c3)OCO4)C2=O)cc(Br)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C28H20BrFN2O6/c1-2-3-18-10-17(12-22(29)25(18)36-14-16-4-6-19(30)7-5-16)11-21-26(33)31-28(35)32(27(21)34)20-8-9-23-24(13-20)38-15-37-23/h2,4-13H,1,3,14-15H2,(H,31,33,35)/b21-11+ |
| InChIKey | ZBJSFTNOOLUOKO-SRZZPIQSSA-N |
| XLogP | 5.29 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.38 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|