C25H15Cl2N3O8 — CID 21216231
(5E)-1-(1,3-benzodioxol-5-yl)-5-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 21216231) has the molecular formula C25H15Cl2N3O8 and a molecular weight of 556.31 g/mol. Its IUPAC name is (5E)-1-(1,3-benzodioxol-5-yl)-5-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(1,3-benzodioxol-5-yl)-5-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 21216231 |
| Molecular Formula | C25H15Cl2N3O8 |
| Molecular Weight | 556.31 g/mol |
| Exact Mass | 555.02 |
| IUPAC Name | (5E)-1-(1,3-benzodioxol-5-yl)-5-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccc3c(c2)OCO3)C(=O)/C1=C/c1cc(Cl)c(OCc2ccc([N+](=O)[O-])cc2)c(Cl)c1 |
| InChI | InChI=1S/C25H15Cl2N3O8/c26-18-8-14(9-19(27)22(18)36-11-13-1-3-15(4-2-13)30(34)35)7-17-23(31)28-25(33)29(24(17)32)16-5-6-20-21(10-16)38-12-37-20/h1-10H,11-12H2,(H,28,31,33)/b17-7+ |
| InChIKey | FXNBKESSYZBHPZ-REZTVBANSA-N |
| XLogP | 4.88 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.31 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|