C27H19BrFN3O6 — CID 124532651
(5E)-5-[[3-bromo-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-1-(4-fluorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 124532651) has the molecular formula C27H19BrFN3O6 and a molecular weight of 580.37 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-1-(4-fluorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3-bromo-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-1-(4-fluorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 124532651 |
| Molecular Formula | C27H19BrFN3O6 |
| Molecular Weight | 580.37 g/mol |
| Exact Mass | 579.04 |
| IUPAC Name | (5E)-5-[[3-bromo-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-1-(4-fluorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(F)cc3)C2=O)cc(Br)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H19BrFN3O6/c1-2-3-18-12-17(14-23(28)24(18)38-15-16-4-8-21(9-5-16)32(36)37)13-22-25(33)30-27(35)31(26(22)34)20-10-6-19(29)7-11-20/h2,4-14H,1,3,15H2,(H,30,33,35)/b22-13+ |
| InChIKey | BVZNEHWLHNPTGL-LPYMAVHISA-N |
| XLogP | 5.47 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.37 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|