C31H27N3O9 — CID 126076378
methyl 4-[(5E)-5-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate (PubChem CID 126076378) has the molecular formula C31H27N3O9 and a molecular weight of 585.57 g/mol. Its IUPAC name is methyl 4-[(5E)-5-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate.
| Compound Name | methyl 4-[(5E)-5-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
|---|---|
| PubChem CID | 126076378 |
| Molecular Formula | C31H27N3O9 |
| Molecular Weight | 585.57 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | methyl 4-[(5E)-5-[[3-ethoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
| SMILES | C=CCc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(C(=O)OC)cc3)C2=O)cc(OCC)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H27N3O9/c1-4-6-22-15-20(17-26(42-5-2)27(22)43-18-19-7-11-24(12-8-19)34(39)40)16-25-28(35)32-31(38)33(29(25)36)23-13-9-21(10-14-23)30(37)41-3/h4,7-17H,1,5-6,18H2,2-3H3,(H,32,35,38)/b25-16+ |
| InChIKey | MOIOCDZGRVAUAW-PCLIKHOPSA-N |
| XLogP | 4.75 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.57 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|