C28H21Cl2N3O7 — CID 126076992
(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-1-(4-nitrophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 126076992) has the molecular formula C28H21Cl2N3O7 and a molecular weight of 582.40 g/mol. Its IUPAC name is (5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-1-(4-nitrophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-1-(4-nitrophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126076992 |
| Molecular Formula | C28H21Cl2N3O7 |
| Molecular Weight | 582.40 g/mol |
| Exact Mass | 581.08 |
| IUPAC Name | (5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-1-(4-nitrophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCc1cc(/C=C2\C(=O)NC(=O)N(c3ccc([N+](=O)[O-])cc3)C2=O)cc(OC)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H21Cl2N3O7/c1-3-4-17-11-16(13-24(39-2)25(17)40-15-18-5-6-19(29)14-23(18)30)12-22-26(34)31-28(36)32(27(22)35)20-7-9-21(10-8-20)33(37)38/h3,5-14H,1,4,15H2,2H3,(H,31,34,36)/b22-12+ |
| InChIKey | CUHOCZONCIWWSH-WSDLNYQXSA-N |
| XLogP | 5.88 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.40 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|