C26H18BrFN2O7 — CID 124532105
(5E)-1-(1,3-benzodioxol-5-yl)-5-[[2-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 124532105) has the molecular formula C26H18BrFN2O7 and a molecular weight of 569.34 g/mol. Its IUPAC name is (5E)-1-(1,3-benzodioxol-5-yl)-5-[[2-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(1,3-benzodioxol-5-yl)-5-[[2-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 124532105 |
| Molecular Formula | C26H18BrFN2O7 |
| Molecular Weight | 569.34 g/mol |
| Exact Mass | 568.03 |
| IUPAC Name | (5E)-1-(1,3-benzodioxol-5-yl)-5-[[2-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc(/C=C2\C(=O)NC(=O)N(c3ccc4c(c3)OCO4)C2=O)c(Br)cc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C26H18BrFN2O7/c1-34-21-9-15(19(27)11-23(21)35-12-14-2-4-16(28)5-3-14)8-18-24(31)29-26(33)30(25(18)32)17-6-7-20-22(10-17)37-13-36-20/h2-11H,12-13H2,1H3,(H,29,31,33)/b18-8+ |
| InChIKey | CWYZNORILRWWAF-QGMBQPNBSA-N |
| XLogP | 4.57 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|