C28H20BrN3O7 — CID 124532005
2-[[4-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-5-bromo-2-ethoxyphenoxy]methyl]benzonitrile (PubChem CID 124532005) has the molecular formula C28H20BrN3O7 and a molecular weight of 590.39 g/mol. Its IUPAC name is 2-[[4-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-5-bromo-2-ethoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-5-bromo-2-ethoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 124532005 |
| Molecular Formula | C28H20BrN3O7 |
| Molecular Weight | 590.39 g/mol |
| Exact Mass | 589.05 |
| IUPAC Name | 2-[[4-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-5-bromo-2-ethoxyphenoxy]methyl]benzonitrile |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(c3ccc4c(c3)OCO4)C2=O)c(Br)cc1OCc1ccccc1C#N |
| InChI | InChI=1S/C28H20BrN3O7/c1-2-36-23-10-18(21(29)12-25(23)37-14-17-6-4-3-5-16(17)13-30)9-20-26(33)31-28(35)32(27(20)34)19-7-8-22-24(11-19)39-15-38-22/h3-12H,2,14-15H2,1H3,(H,31,33,35)/b20-9+ |
| InChIKey | VJDNTAGHFQPHKC-AWQFTUOYSA-N |
| XLogP | 4.69 |
| TPSA | 127.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|