C28H21BrN2O9 — CID 124531999
3-[[4-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-bromo-6-ethoxyphenoxy]methyl]benzoic acid (PubChem CID 124531999) has the molecular formula C28H21BrN2O9 and a molecular weight of 609.39 g/mol. Its IUPAC name is 3-[[4-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-bromo-6-ethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-bromo-6-ethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 124531999 |
| Molecular Formula | C28H21BrN2O9 |
| Molecular Weight | 609.39 g/mol |
| Exact Mass | 608.04 |
| IUPAC Name | 3-[[4-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-bromo-6-ethoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(c3ccc4c(c3)OCO4)C2=O)cc(Br)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C28H21BrN2O9/c1-2-37-23-11-16(10-20(29)24(23)38-13-15-4-3-5-17(8-15)27(34)35)9-19-25(32)30-28(36)31(26(19)33)18-6-7-21-22(12-18)40-14-39-21/h3-12H,2,13-14H2,1H3,(H,34,35)(H,30,32,36)/b19-9+ |
| InChIKey | AIBBNVRHVISJEO-DJKKODMXSA-N |
| XLogP | 4.52 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|