C27H20N2O9 — CID 126192878
4-[[2-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126192878) has the molecular formula C27H20N2O9 and a molecular weight of 516.46 g/mol. Its IUPAC name is 4-[[2-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126192878 |
| Molecular Formula | C27H20N2O9 |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 4-[[2-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cccc(/C=C2\C(=O)NC(=O)N(c3ccc4c(c3)OCO4)C2=O)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C27H20N2O9/c1-35-21-4-2-3-17(23(21)36-13-15-5-7-16(8-6-15)26(32)33)11-19-24(30)28-27(34)29(25(19)31)18-9-10-20-22(12-18)38-14-37-20/h2-12H,13-14H2,1H3,(H,32,33)(H,28,30,34)/b19-11+ |
| InChIKey | FSKBATQCFGRXOV-YBFXNURJSA-N |
| XLogP | 3.37 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|