C27H20FN3O8 — CID 21168526
2-[2-[(Z)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 21168526) has the molecular formula C27H20FN3O8 and a molecular weight of 533.47 g/mol. Its IUPAC name is 2-[2-[(Z)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[2-[(Z)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 21168526 |
| Molecular Formula | C27H20FN3O8 |
| Molecular Weight | 533.47 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 2-[2-[(Z)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | COc1cccc(/C=C2/C(=O)NC(=O)N(c3ccc4c(c3)OCO4)C2=O)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C27H20FN3O8/c1-36-21-4-2-3-15(24(21)37-13-23(32)29-17-7-5-16(28)6-8-17)11-19-25(33)30-27(35)31(26(19)34)18-9-10-20-22(12-18)39-14-38-20/h2-12H,13-14H2,1H3,(H,29,32)(H,30,33,35)/b19-11- |
| InChIKey | AXKVJBKBFQNTJK-ODLFYWEKSA-N |
| XLogP | 3.25 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|