C27H19ClFN3O8 — CID 124532068
2-[4-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-chloro-6-methoxyphenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 124532068) has the molecular formula C27H19ClFN3O8 and a molecular weight of 567.91 g/mol. Its IUPAC name is 2-[4-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-chloro-6-methoxyphenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-chloro-6-methoxyphenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 124532068 |
| Molecular Formula | C27H19ClFN3O8 |
| Molecular Weight | 567.91 g/mol |
| Exact Mass | 567.08 |
| IUPAC Name | 2-[4-[(E)-[1-(1,3-benzodioxol-5-yl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-chloro-6-methoxyphenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | COc1cc(/C=C2\C(=O)NC(=O)N(c3ccc4c(c3)OCO4)C2=O)cc(Cl)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C27H19ClFN3O8/c1-37-22-10-14(9-19(28)24(22)38-12-23(33)30-16-4-2-15(29)3-5-16)8-18-25(34)31-27(36)32(26(18)35)17-6-7-20-21(11-17)40-13-39-20/h2-11H,12-13H2,1H3,(H,30,33)(H,31,34,36)/b18-8+ |
| InChIKey | AZHSOVWIAVBYEQ-QGMBQPNBSA-N |
| XLogP | 3.90 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.91 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|