C28H24N2O7S — CID 126190611
4-[[2-[(E)-[1-(3-ethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126190611) has the molecular formula C28H24N2O7S and a molecular weight of 532.57 g/mol. Its IUPAC name is 4-[[2-[(E)-[1-(3-ethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-[(E)-[1-(3-ethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126190611 |
| Molecular Formula | C28H24N2O7S |
| Molecular Weight | 532.57 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | 4-[[2-[(E)-[1-(3-ethoxyphenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1cccc(N2C(=O)/C(=C/c3cccc(OC)c3OCc3ccc(C(=O)O)cc3)C(=O)NC2=S)c1 |
| InChI | InChI=1S/C28H24N2O7S/c1-3-36-21-8-5-7-20(15-21)30-26(32)22(25(31)29-28(30)38)14-19-6-4-9-23(35-2)24(19)37-16-17-10-12-18(13-11-17)27(33)34/h4-15H,3,16H2,1-2H3,(H,33,34)(H,29,31,38)/b22-14+ |
| InChIKey | KQQVBMROQBCLBS-HYARGMPZSA-N |
| XLogP | 4.20 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|