C27H20BrFN2O6S — CID 5227347
3-[5-[[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid (PubChem CID 5227347) has the molecular formula C27H20BrFN2O6S and a molecular weight of 599.43 g/mol. Its IUPAC name is 3-[5-[[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid.
| Compound Name | 3-[5-[[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
|---|---|
| PubChem CID | 5227347 |
| Molecular Formula | C27H20BrFN2O6S |
| Molecular Weight | 599.43 g/mol |
| Exact Mass | 598.02 |
| IUPAC Name | 3-[5-[[2-bromo-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
| SMILES | CCOc1cc(C=C2C(=O)NC(=S)N(c3cccc(C(=O)O)c3)C2=O)c(Br)cc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C27H20BrFN2O6S/c1-2-36-22-12-17(21(28)13-23(22)37-14-15-6-8-18(29)9-7-15)11-20-24(32)30-27(38)31(25(20)33)19-5-3-4-16(10-19)26(34)35/h3-13H,2,14H2,1H3,(H,34,35)(H,30,32,38) |
| InChIKey | UCDCECRWTIXROS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|