C27H23BrN2O4S — CID 126381758
(5E)-5-[(2-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126381758) has the molecular formula C27H23BrN2O4S and a molecular weight of 551.46 g/mol. Its IUPAC name is (5E)-5-[(2-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-5-[(2-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126381758 |
| Molecular Formula | C27H23BrN2O4S |
| Molecular Weight | 551.46 g/mol |
| Exact Mass | 550.06 |
| IUPAC Name | (5E)-5-[(2-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCc1ccc(N2C(=O)/C(=C/c3cc(OC)c(OCc4ccccc4)cc3Br)C(=O)NC2=S)cc1 |
| InChI | InChI=1S/C27H23BrN2O4S/c1-3-17-9-11-20(12-10-17)30-26(32)21(25(31)29-27(30)35)13-19-14-23(33-2)24(15-22(19)28)34-16-18-7-5-4-6-8-18/h4-15H,3,16H2,1-2H3,(H,29,31,35)/b21-13+ |
| InChIKey | GOSHEAFHWXGXCO-FYJGNVAPSA-N |
| XLogP | 5.43 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.46 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|