C32H27BrN2O4S — CID 126383205
(5E)-5-[[2-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126383205) has the molecular formula C32H27BrN2O4S and a molecular weight of 615.55 g/mol. Its IUPAC name is (5E)-5-[[2-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-5-[[2-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126383205 |
| Molecular Formula | C32H27BrN2O4S |
| Molecular Weight | 615.55 g/mol |
| Exact Mass | 614.09 |
| IUPAC Name | (5E)-5-[[2-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=S)N(c3ccc(CC)cc3)C2=O)c(Br)cc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C32H27BrN2O4S/c1-3-20-12-14-24(15-13-20)35-31(37)26(30(36)34-32(35)40)16-23-17-28(38-4-2)29(18-27(23)33)39-19-22-10-7-9-21-8-5-6-11-25(21)22/h5-18H,3-4,19H2,1-2H3,(H,34,36,40)/b26-16+ |
| InChIKey | QNPGPXXPICGXMQ-WGOQTCKBSA-N |
| XLogP | 6.97 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.55 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|