C27H21BrCl2N2O4S — CID 126380156
(5E)-5-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126380156) has the molecular formula C27H21BrCl2N2O4S and a molecular weight of 620.35 g/mol. Its IUPAC name is (5E)-5-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-5-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126380156 |
| Molecular Formula | C27H21BrCl2N2O4S |
| Molecular Weight | 620.35 g/mol |
| Exact Mass | 617.98 |
| IUPAC Name | (5E)-5-[[2-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-(4-ethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCc1ccc(N2C(=O)/C(=C/c3cc(OC)c(OCc4ccc(Cl)c(Cl)c4)cc3Br)C(=O)NC2=S)cc1 |
| InChI | InChI=1S/C27H21BrCl2N2O4S/c1-3-15-4-7-18(8-5-15)32-26(34)19(25(33)31-27(32)37)11-17-12-23(35-2)24(13-20(17)28)36-14-16-6-9-21(29)22(30)10-16/h4-13H,3,14H2,1-2H3,(H,31,33,37)/b19-11+ |
| InChIKey | MOUSBGXHVJWKKH-YBFXNURJSA-N |
| XLogP | 6.74 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.35 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|