C32H26N2O6S — CID 90823424
5-[(4,5-dimethoxy-2-phenylmethoxyphenyl)methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 90823424) has the molecular formula C32H26N2O6S and a molecular weight of 566.64 g/mol. Its IUPAC name is 5-[(4,5-dimethoxy-2-phenylmethoxyphenyl)methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(4,5-dimethoxy-2-phenylmethoxyphenyl)methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 90823424 |
| Molecular Formula | C32H26N2O6S |
| Molecular Weight | 566.64 g/mol |
| Exact Mass | 566.15 |
| IUPAC Name | 5-[(4,5-dimethoxy-2-phenylmethoxyphenyl)methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1cc(C=C2C(=O)NC(=S)N(c3ccc(Oc4ccccc4)cc3)C2=O)c(OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C32H26N2O6S/c1-37-28-18-22(27(19-29(28)38-2)39-20-21-9-5-3-6-10-21)17-26-30(35)33-32(41)34(31(26)36)23-13-15-25(16-14-23)40-24-11-7-4-8-12-24/h3-19H,20H2,1-2H3,(H,33,35,41) |
| InChIKey | VCSXQRZKMDCLRG-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.64 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|