C28H20ClN3O5S — CID 90699585
5-[(2-chloro-6,7-dimethoxyquinolin-3-yl)methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 90699585) has the molecular formula C28H20ClN3O5S and a molecular weight of 546.00 g/mol. Its IUPAC name is 5-[(2-chloro-6,7-dimethoxyquinolin-3-yl)methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(2-chloro-6,7-dimethoxyquinolin-3-yl)methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 90699585 |
| Molecular Formula | C28H20ClN3O5S |
| Molecular Weight | 546.00 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | 5-[(2-chloro-6,7-dimethoxyquinolin-3-yl)methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1cc2cc(C=C3C(=O)NC(=S)N(c4ccc(Oc5ccccc5)cc4)C3=O)c(Cl)nc2cc1OC |
| InChI | InChI=1S/C28H20ClN3O5S/c1-35-23-14-16-12-17(25(29)30-22(16)15-24(23)36-2)13-21-26(33)31-28(38)32(27(21)34)18-8-10-20(11-9-18)37-19-6-4-3-5-7-19/h3-15H,1-2H3,(H,31,33,38) |
| InChIKey | UEOCIRBKFYZURV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.00 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|