C31H24N2O4S — CID 91447432
5-[(2-methyl-4-phenylmethoxyphenyl)methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 91447432) has the molecular formula C31H24N2O4S and a molecular weight of 520.61 g/mol. Its IUPAC name is 5-[(2-methyl-4-phenylmethoxyphenyl)methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(2-methyl-4-phenylmethoxyphenyl)methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 91447432 |
| Molecular Formula | C31H24N2O4S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | 5-[(2-methyl-4-phenylmethoxyphenyl)methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1cc(OCc2ccccc2)ccc1C=C1C(=O)NC(=S)N(c2ccc(Oc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C31H24N2O4S/c1-21-18-27(36-20-22-8-4-2-5-9-22)15-12-23(21)19-28-29(34)32-31(38)33(30(28)35)24-13-16-26(17-14-24)37-25-10-6-3-7-11-25/h2-19H,20H2,1H3,(H,32,34,38) |
| InChIKey | JRWAIQFUBRYPJJ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|