C28H26N2O6S — CID 90708620
5-[[4-(4-hydroxybutoxy)-3-methoxyphenyl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 90708620) has the molecular formula C28H26N2O6S and a molecular weight of 518.59 g/mol. Its IUPAC name is 5-[[4-(4-hydroxybutoxy)-3-methoxyphenyl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[4-(4-hydroxybutoxy)-3-methoxyphenyl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 90708620 |
| Molecular Formula | C28H26N2O6S |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 5-[[4-(4-hydroxybutoxy)-3-methoxyphenyl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1cc(C=C2C(=O)NC(=S)N(c3ccc(Oc4ccccc4)cc3)C2=O)ccc1OCCCCO |
| InChI | InChI=1S/C28H26N2O6S/c1-34-25-18-19(9-14-24(25)35-16-6-5-15-31)17-23-26(32)29-28(37)30(27(23)33)20-10-12-22(13-11-20)36-21-7-3-2-4-8-21/h2-4,7-14,17-18,31H,5-6,15-16H2,1H3,(H,29,32,37) |
| InChIKey | IYSGAPLHIWAQQZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|