C29H27N3O4S2 — CID 90722164
5-[[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 90722164) has the molecular formula C29H27N3O4S2 and a molecular weight of 545.69 g/mol. Its IUPAC name is 5-[[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 90722164 |
| Molecular Formula | C29H27N3O4S2 |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | 5-[[4-methoxy-3-(thiomorpholin-4-ylmethyl)phenyl]methylidene]-1-(4-phenoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1ccc(C=C2C(=O)NC(=S)N(c3ccc(Oc4ccccc4)cc3)C2=O)cc1CN1CCSCC1 |
| InChI | InChI=1S/C29H27N3O4S2/c1-35-26-12-7-20(17-21(26)19-31-13-15-38-16-14-31)18-25-27(33)30-29(37)32(28(25)34)22-8-10-24(11-9-22)36-23-5-3-2-4-6-23/h2-12,17-18H,13-16,19H2,1H3,(H,30,33,37) |
| InChIKey | ONIMPUJWRBVZLW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|