C29H24BrN3O7S — CID 4695157
3-[5-[[2-bromo-5-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid (PubChem CID 4695157) has the molecular formula C29H24BrN3O7S and a molecular weight of 638.50 g/mol. Its IUPAC name is 3-[5-[[2-bromo-5-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid.
| Compound Name | 3-[5-[[2-bromo-5-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
|---|---|
| PubChem CID | 4695157 |
| Molecular Formula | C29H24BrN3O7S |
| Molecular Weight | 638.50 g/mol |
| Exact Mass | 637.05 |
| IUPAC Name | 3-[5-[[2-bromo-5-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl]benzoic acid |
| SMILES | CCOc1cc(C=C2C(=O)NC(=S)N(c3cccc(C(=O)O)c3)C2=O)c(Br)cc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C29H24BrN3O7S/c1-3-39-23-13-18(22(30)14-24(23)40-15-25(34)31-19-9-7-16(2)8-10-19)12-21-26(35)32-29(41)33(27(21)36)20-6-4-5-17(11-20)28(37)38/h4-14H,3,15H2,1-2H3,(H,31,34)(H,37,38)(H,32,35,41) |
| InChIKey | QRVMIONEEIRVGU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|