C24H24BrNO7 — CID 168599385
2-[5-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 168599385) has the molecular formula C24H24BrNO7 and a molecular weight of 518.36 g/mol. Its IUPAC name is 2-[5-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[5-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 168599385 |
| Molecular Formula | C24H24BrNO7 |
| Molecular Weight | 518.36 g/mol |
| Exact Mass | 517.07 |
| IUPAC Name | 2-[5-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(C=C2C(=O)OC(C)(C)OC2=O)c(Br)cc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C24H24BrNO7/c1-5-30-19-11-15(10-17-22(28)32-24(3,4)33-23(17)29)18(25)12-20(19)31-13-21(27)26-16-8-6-14(2)7-9-16/h6-12H,5,13H2,1-4H3,(H,26,27) |
| InChIKey | PTNXJQIWNWEZMG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|