C19H21BrO8 — CID 168599399
ethyl 2-[5-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-ethoxyphenoxy]acetate (PubChem CID 168599399) has the molecular formula C19H21BrO8 and a molecular weight of 457.27 g/mol. Its IUPAC name is ethyl 2-[5-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-ethoxyphenoxy]acetate.
| Compound Name | ethyl 2-[5-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 168599399 |
| Molecular Formula | C19H21BrO8 |
| Molecular Weight | 457.27 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | ethyl 2-[5-bromo-4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-ethoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(Br)c(C=C2C(=O)OC(C)(C)OC2=O)cc1OCC |
| InChI | InChI=1S/C19H21BrO8/c1-5-24-14-8-11(7-12-17(22)27-19(3,4)28-18(12)23)13(20)9-15(14)26-10-16(21)25-6-2/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | CBIIJPWWRBSBOF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|