C18H19IO8 — CID 168599369
ethyl 2-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-iodo-6-methoxyphenoxy]acetate (PubChem CID 168599369) has the molecular formula C18H19IO8 and a molecular weight of 490.25 g/mol. Its IUPAC name is ethyl 2-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-iodo-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-iodo-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 168599369 |
| Molecular Formula | C18H19IO8 |
| Molecular Weight | 490.25 g/mol |
| Exact Mass | 490.01 |
| IUPAC Name | ethyl 2-[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-iodo-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(C=C2C(=O)OC(C)(C)OC2=O)cc1OC |
| InChI | InChI=1S/C18H19IO8/c1-5-24-14(20)9-25-15-12(19)7-10(8-13(15)23-4)6-11-16(21)26-18(2,3)27-17(11)22/h6-8H,5,9H2,1-4H3 |
| InChIKey | NSOZHCJVKIQEKD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|