C17H19IO6 — CID 168599884
5-[(3,4-diethoxy-5-iodophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168599884) has the molecular formula C17H19IO6 and a molecular weight of 446.24 g/mol. Its IUPAC name is 5-[(3,4-diethoxy-5-iodophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(3,4-diethoxy-5-iodophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168599884 |
| Molecular Formula | C17H19IO6 |
| Molecular Weight | 446.24 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | 5-[(3,4-diethoxy-5-iodophenyl)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCOc1cc(C=C2C(=O)OC(C)(C)OC2=O)cc(I)c1OCC |
| InChI | InChI=1S/C17H19IO6/c1-5-21-13-9-10(8-12(18)14(13)22-6-2)7-11-15(19)23-17(3,4)24-16(11)20/h7-9H,5-6H2,1-4H3 |
| InChIKey | PBFNCUMUALPHJK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|