C22H19IO7 — CID 168599357
[4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-ethoxy-6-iodophenyl] benzoate (PubChem CID 168599357) has the molecular formula C22H19IO7 and a molecular weight of 522.29 g/mol. Its IUPAC name is [4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-ethoxy-6-iodophenyl] benzoate.
| Compound Name | [4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-ethoxy-6-iodophenyl] benzoate |
|---|---|
| PubChem CID | 168599357 |
| Molecular Formula | C22H19IO7 |
| Molecular Weight | 522.29 g/mol |
| Exact Mass | 522.02 |
| IUPAC Name | [4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methyl]-2-ethoxy-6-iodophenyl] benzoate |
| SMILES | CCOc1cc(C=C2C(=O)OC(C)(C)OC2=O)cc(I)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H19IO7/c1-4-27-17-12-13(10-15-20(25)29-22(2,3)30-21(15)26)11-16(23)18(17)28-19(24)14-8-6-5-7-9-14/h5-12H,4H2,1-3H3 |
| InChIKey | ZHTZYRWIJZBECV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|