C25H17IN2O7 — CID 19665102
[2-ethoxy-6-iodo-4-[(Z)-[2-(4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate (PubChem CID 19665102) has the molecular formula C25H17IN2O7 and a molecular weight of 584.32 g/mol. Its IUPAC name is [2-ethoxy-6-iodo-4-[(Z)-[2-(4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate.
| Compound Name | [2-ethoxy-6-iodo-4-[(Z)-[2-(4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 19665102 |
| Molecular Formula | C25H17IN2O7 |
| Molecular Weight | 584.32 g/mol |
| Exact Mass | 584.01 |
| IUPAC Name | [2-ethoxy-6-iodo-4-[(Z)-[2-(4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] benzoate |
| SMILES | CCOc1cc(/C=C2\N=C(c3ccc([N+](=O)[O-])cc3)OC2=O)cc(I)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H17IN2O7/c1-2-33-21-14-15(12-19(26)22(21)34-24(29)17-6-4-3-5-7-17)13-20-25(30)35-23(27-20)16-8-10-18(11-9-16)28(31)32/h3-14H,2H2,1H3/b20-13- |
| InChIKey | YRLWAZWCCAGIML-MOSHPQCFSA-N |
| XLogP | 5.16 |
| TPSA | 117.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.32 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|