C20H15ClN2O7 — CID 3103940
[2-chloro-6-ethoxy-4-[[2-(4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate (PubChem CID 3103940) has the molecular formula C20H15ClN2O7 and a molecular weight of 430.80 g/mol. Its IUPAC name is [2-chloro-6-ethoxy-4-[[2-(4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate.
| Compound Name | [2-chloro-6-ethoxy-4-[[2-(4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 3103940 |
| Molecular Formula | C20H15ClN2O7 |
| Molecular Weight | 430.80 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | [2-chloro-6-ethoxy-4-[[2-(4-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] acetate |
| SMILES | CCOc1cc(C=C2N=C(c3ccc([N+](=O)[O-])cc3)OC2=O)cc(Cl)c1OC(C)=O |
| InChI | InChI=1S/C20H15ClN2O7/c1-3-28-17-10-12(8-15(21)18(17)29-11(2)24)9-16-20(25)30-19(22-16)13-4-6-14(7-5-13)23(26)27/h4-10H,3H2,1-2H3 |
| InChIKey | FSCZMAZTZPGSBN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 117.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.80 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|