C21H16Cl2N2O7 — CID 19662291
[2-chloro-4-[(Z)-[2-(4-chloro-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-ethoxyphenyl] propanoate (PubChem CID 19662291) has the molecular formula C21H16Cl2N2O7 and a molecular weight of 479.27 g/mol. Its IUPAC name is [2-chloro-4-[(Z)-[2-(4-chloro-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-ethoxyphenyl] propanoate.
| Compound Name | [2-chloro-4-[(Z)-[2-(4-chloro-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-ethoxyphenyl] propanoate |
|---|---|
| PubChem CID | 19662291 |
| Molecular Formula | C21H16Cl2N2O7 |
| Molecular Weight | 479.27 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | [2-chloro-4-[(Z)-[2-(4-chloro-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-ethoxyphenyl] propanoate |
| SMILES | CCOc1cc(/C=C2\N=C(c3ccc(Cl)c([N+](=O)[O-])c3)OC2=O)cc(Cl)c1OC(=O)CC |
| InChI | InChI=1S/C21H16Cl2N2O7/c1-3-18(26)31-19-14(23)7-11(9-17(19)30-4-2)8-15-21(27)32-20(24-15)12-5-6-13(22)16(10-12)25(28)29/h5-10H,3-4H2,1-2H3/b15-8- |
| InChIKey | RUCYRAIQMQWWIQ-NVNXTCNLSA-N |
| XLogP | 4.96 |
| TPSA | 117.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.27 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|