C21H16Cl2N2O8 — CID 19662603
ethyl 2-[2-chloro-4-[(Z)-[2-(4-chloro-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-methoxyphenoxy]acetate (PubChem CID 19662603) has the molecular formula C21H16Cl2N2O8 and a molecular weight of 495.27 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-[(Z)-[2-(4-chloro-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[2-chloro-4-[(Z)-[2-(4-chloro-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 19662603 |
| Molecular Formula | C21H16Cl2N2O8 |
| Molecular Weight | 495.27 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | ethyl 2-[2-chloro-4-[(Z)-[2-(4-chloro-3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(/C=C2\N=C(c3ccc(Cl)c([N+](=O)[O-])c3)OC2=O)cc1OC |
| InChI | InChI=1S/C21H16Cl2N2O8/c1-3-31-18(26)10-32-19-14(23)6-11(8-17(19)30-2)7-15-21(27)33-20(24-15)12-4-5-13(22)16(9-12)25(28)29/h4-9H,3,10H2,1-2H3/b15-7- |
| InChIKey | SEFUZGHNKBSZSK-CHHVJCJISA-N |
| XLogP | 4.20 |
| TPSA | 126.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.27 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|