C20H15ClN2O8 — CID 19664676
methyl 2-[2-chloro-6-methoxy-4-[(Z)-[2-(3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate (PubChem CID 19664676) has the molecular formula C20H15ClN2O8 and a molecular weight of 446.80 g/mol. Its IUPAC name is methyl 2-[2-chloro-6-methoxy-4-[(Z)-[2-(3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-chloro-6-methoxy-4-[(Z)-[2-(3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 19664676 |
| Molecular Formula | C20H15ClN2O8 |
| Molecular Weight | 446.80 g/mol |
| Exact Mass | 446.05 |
| IUPAC Name | methyl 2-[2-chloro-6-methoxy-4-[(Z)-[2-(3-nitrophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1c(Cl)cc(/C=C2\N=C(c3cccc([N+](=O)[O-])c3)OC2=O)cc1OC |
| InChI | InChI=1S/C20H15ClN2O8/c1-28-16-8-11(6-14(21)18(16)30-10-17(24)29-2)7-15-20(25)31-19(22-15)12-4-3-5-13(9-12)23(26)27/h3-9H,10H2,1-2H3/b15-7- |
| InChIKey | GDQOSLUIMSZHBL-CHHVJCJISA-N |
| XLogP | 3.15 |
| TPSA | 126.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.80 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|