C21H18ClNO7 — CID 78414641
methyl 2-[2-chloro-6-methoxy-4-[[2-(3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate (PubChem CID 78414641) has the molecular formula C21H18ClNO7 and a molecular weight of 431.83 g/mol. Its IUPAC name is methyl 2-[2-chloro-6-methoxy-4-[[2-(3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-chloro-6-methoxy-4-[[2-(3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 78414641 |
| Molecular Formula | C21H18ClNO7 |
| Molecular Weight | 431.83 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | methyl 2-[2-chloro-6-methoxy-4-[[2-(3-methoxyphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1c(Cl)cc(C=C2N=C(c3cccc(OC)c3)OC2=O)cc1OC |
| InChI | InChI=1S/C21H18ClNO7/c1-26-14-6-4-5-13(10-14)20-23-16(21(25)30-20)8-12-7-15(22)19(17(9-12)27-2)29-11-18(24)28-3/h4-10H,11H2,1-3H3 |
| InChIKey | CIBFQPHMCVHLSQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 92.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.83 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|