C28H19ClN2O6 — CID 19674810
(4Z)-4-[[3-chloro-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-2-naphthalen-2-yl-1,3-oxazol-5-one (PubChem CID 19674810) has the molecular formula C28H19ClN2O6 and a molecular weight of 514.92 g/mol. Its IUPAC name is (4Z)-4-[[3-chloro-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-2-naphthalen-2-yl-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[[3-chloro-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-2-naphthalen-2-yl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 19674810 |
| Molecular Formula | C28H19ClN2O6 |
| Molecular Weight | 514.92 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | (4Z)-4-[[3-chloro-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-2-naphthalen-2-yl-1,3-oxazol-5-one |
| SMILES | COc1cc(/C=C2\N=C(c3ccc4ccccc4c3)OC2=O)cc(Cl)c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H19ClN2O6/c1-35-25-14-18(12-23(29)26(25)36-16-17-5-4-8-22(11-17)31(33)34)13-24-28(32)37-27(30-24)21-10-9-19-6-2-3-7-20(19)15-21/h2-15H,16H2,1H3/b24-13- |
| InChIKey | RXAYSKDTGQASMP-CFRMEGHHSA-N |
| XLogP | 6.33 |
| TPSA | 100.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.92 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|