C29H27ClN2O6 — CID 6516995
(4Z)-2-(4-tert-butylphenyl)-4-[[3-chloro-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one (PubChem CID 6516995) has the molecular formula C29H27ClN2O6 and a molecular weight of 535.00 g/mol. Its IUPAC name is (4Z)-2-(4-tert-butylphenyl)-4-[[3-chloro-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(4-tert-butylphenyl)-4-[[3-chloro-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6516995 |
| Molecular Formula | C29H27ClN2O6 |
| Molecular Weight | 535.00 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | (4Z)-2-(4-tert-butylphenyl)-4-[[3-chloro-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-1,3-oxazol-5-one |
| SMILES | CCOc1cc(/C=C2\N=C(c3ccc(C(C)(C)C)cc3)OC2=O)cc(Cl)c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H27ClN2O6/c1-5-36-25-16-19(14-23(30)26(25)37-17-18-7-6-8-22(13-18)32(34)35)15-24-28(33)38-27(31-24)20-9-11-21(12-10-20)29(2,3)4/h6-16H,5,17H2,1-4H3/b24-15- |
| InChIKey | MAWTWRYPDODROE-IWIPYMOSSA-N |
| XLogP | 6.87 |
| TPSA | 100.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.00 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|